C16H22O6 — CID 67712886
formic acid;5-methoxy-2,2,4,6,7-pentamethyl-3H-1-benzofuran-3-carboxylic acid (PubChem CID 67712886) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is formic acid;5-methoxy-2,2,4,6,7-pentamethyl-3H-1-benzofuran-3-carboxylic acid.
| Compound Name | formic acid;5-methoxy-2,2,4,6,7-pentamethyl-3H-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 67712886 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | formic acid;5-methoxy-2,2,4,6,7-pentamethyl-3H-1-benzofuran-3-carboxylic acid |
| SMILES | COc1c(C)c(C)c2c(c1C)C(C(=O)O)C(C)(C)O2.O=CO |
| InChI | InChI=1S/C15H20O4.CH2O2/c1-7-8(2)13-10(9(3)12(7)18-6)11(14(16)17)15(4,5)19-13;2-1-3/h11H,1-6H3,(H,16,17);1H,(H,2,3) |
| InChIKey | MZCVVOWSEAALPM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|