C28H33NO6S — CID 67713467
3-(hydroxymethyl)-N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]-N-phenylbenzenesulfonamide (PubChem CID 67713467) has the molecular formula C28H33NO6S and a molecular weight of 511.64 g/mol. Its IUPAC name is 3-(hydroxymethyl)-N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]-N-phenylbenzenesulfonamide.
| Compound Name | 3-(hydroxymethyl)-N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 67713467 |
| Molecular Formula | C28H33NO6S |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 3-(hydroxymethyl)-N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]-N-phenylbenzenesulfonamide |
| SMILES | CCCC(c1c(O)c2c(oc1=O)CCCCCC2)N(c1ccccc1)S(=O)(=O)c1cccc(CO)c1 |
| InChI | InChI=1S/C28H33NO6S/c1-2-11-24(26-27(31)23-16-8-3-4-9-17-25(23)35-28(26)32)29(21-13-6-5-7-14-21)36(33,34)22-15-10-12-20(18-22)19-30/h5-7,10,12-15,18,24,30-31H,2-4,8-9,11,16-17,19H2,1H3 |
| InChIKey | QOPSLYZRTYFXSN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |