About 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;methoxymethane
5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;methoxymethane (PubChem CID 67713557) has the molecular formula C18H32O2
and a molecular weight of 280.45 g/mol. Its IUPAC name is 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;methoxymethane.
Molecular Properties
| Compound Name | 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;methoxymethane |
| PubChem CID | 67713557 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;methoxymethane |
| SMILES | C=COC1(C(C)(C)C)C=CC=CC1C(C)(C)C.COC |
| InChI | InChI=1S/C16H26O.C2H6O/c1-8-17-16(15(5,6)7)12-10-9-11-13(16)14(2,3)4;1-3-2/h8-13H,1H2,2-7H3;1-2H3 |
| InChIKey | ZWIQWRDUGBMEGO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;methoxymethane?
The IUPAC name of 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;methoxymethane (CID 67713557) is 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;methoxymethane.
What is the SMILES notation for 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;methoxymethane?
The canonical SMILES for 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;methoxymethane is C=COC1(C(C)(C)C)C=CC=CC1C(C)(C)C.COC.
What is the InChIKey of 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;methoxymethane?
The InChIKey is ZWIQWRDUGBMEGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O.C2H6O/c1-8-17-16(15(5,6)7)12-10-9-11-13(16)14(2,3)4;1-3-2/h8-13H,1H2,2-7H3;1-2H3.
What are the key properties of 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;methoxymethane?
5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;methoxymethane has a molecular weight of 280.45 g/mol, XLogP of 4.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;methoxymethane is sourced from PubChem (CID 67713557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).