C28H31N3O5S2 — CID 67713730
N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)-3-methylbutyl]-N-phenyl-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 67713730) has the molecular formula C28H31N3O5S2 and a molecular weight of 553.71 g/mol. Its IUPAC name is N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)-3-methylbutyl]-N-phenyl-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)-3-methylbutyl]-N-phenyl-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 67713730 |
| Molecular Formula | C28H31N3O5S2 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)-3-methylbutyl]-N-phenyl-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | CC(C)CC(c1c(O)c2c(oc1=O)CCCCCC2)N(c1ccccc1)S(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C28H31N3O5S2/c1-18(2)17-22(25-27(32)20-13-8-3-4-9-15-23(20)36-28(25)33)31(19-11-6-5-7-12-19)38(34,35)24-16-10-14-21-26(24)30-37-29-21/h5-7,10-12,14,16,18,22,32H,3-4,8-9,13,15,17H2,1-2H3 |
| InChIKey | PMEWVCPLRWDKSG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|