About 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane
5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane (PubChem CID 67713749) has the molecular formula C24H44O2
and a molecular weight of 364.61 g/mol. Its IUPAC name is 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane.
Molecular Properties
| Compound Name | 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
| PubChem CID | 67713749 |
| Molecular Formula | C24H44O2 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.33 |
| IUPAC Name | 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
| SMILES | C=COC1(C(C)(C)C)C=CC=CC1C(C)(C)C.CC(C)(C)OC(C)(C)C |
| InChI | InChI=1S/C16H26O.C8H18O/c1-8-17-16(15(5,6)7)12-10-9-11-13(16)14(2,3)4;1-7(2,3)9-8(4,5)6/h8-13H,1H2,2-7H3;1-6H3 |
| InChIKey | YHJIQGKHNWRDDZ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The IUPAC name of 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane (CID 67713749) is 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane.
What is the SMILES notation for 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The canonical SMILES for 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane is C=COC1(C(C)(C)C)C=CC=CC1C(C)(C)C.CC(C)(C)OC(C)(C)C.
What is the InChIKey of 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The InChIKey is YHJIQGKHNWRDDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O.C8H18O/c1-8-17-16(15(5,6)7)12-10-9-11-13(16)14(2,3)4;1-7(2,3)9-8(4,5)6/h8-13H,1H2,2-7H3;1-6H3.
What are the key properties of 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane has a molecular weight of 364.61 g/mol, XLogP of 7.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane is sourced from PubChem (CID 67713749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).