C24H44O2 — CID 67713769
2,5-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane (PubChem CID 67713769) has the molecular formula C24H44O2 and a molecular weight of 364.61 g/mol. Its IUPAC name is 2,5-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane.
| Compound Name | 2,5-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
|---|---|
| PubChem CID | 67713769 |
| Molecular Formula | C24H44O2 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.33 |
| IUPAC Name | 2,5-ditert-butyl-5-ethenoxycyclohexa-1,3-diene;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
| SMILES | C=COC1(C(C)(C)C)C=CC(C(C)(C)C)=CC1.CC(C)(C)OC(C)(C)C |
| InChI | InChI=1S/C16H26O.C8H18O/c1-8-17-16(15(5,6)7)11-9-13(10-12-16)14(2,3)4;1-7(2,3)9-8(4,5)6/h8-11H,1,12H2,2-7H3;1-6H3 |
| InChIKey | HSHMMOMJDHCHCY-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|