About (2S)-2-but-2-enyl-2,3-dihydroinden-1-one
(2S)-2-but-2-enyl-2,3-dihydroinden-1-one (PubChem CID 67713890) has the molecular formula C13H14O
and a molecular weight of 186.25 g/mol. Its IUPAC name is (2S)-2-but-2-enyl-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | (2S)-2-but-2-enyl-2,3-dihydroinden-1-one |
| PubChem CID | 67713890 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (2S)-2-but-2-enyl-2,3-dihydroinden-1-one |
| SMILES | CC=CC[C@H]1Cc2ccccc2C1=O |
| InChI | InChI=1S/C13H14O/c1-2-3-6-11-9-10-7-4-5-8-12(10)13(11)14/h2-5,7-8,11H,6,9H2,1H3/t11-/m0/s1 |
| InChIKey | KJHKPUAQPBUOEB-NSHDSACASA-N |
| XLogP | 3.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-but-2-enyl-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-but-2-enyl-2,3-dihydroinden-1-one?
The IUPAC name of (2S)-2-but-2-enyl-2,3-dihydroinden-1-one (CID 67713890) is (2S)-2-but-2-enyl-2,3-dihydroinden-1-one.
What is the SMILES notation for (2S)-2-but-2-enyl-2,3-dihydroinden-1-one?
The canonical SMILES for (2S)-2-but-2-enyl-2,3-dihydroinden-1-one is CC=CC[C@H]1Cc2ccccc2C1=O.
What is the InChIKey of (2S)-2-but-2-enyl-2,3-dihydroinden-1-one?
The InChIKey is KJHKPUAQPBUOEB-NSHDSACASA-N. The full InChI is InChI=1S/C13H14O/c1-2-3-6-11-9-10-7-4-5-8-12(10)13(11)14/h2-5,7-8,11H,6,9H2,1H3/t11-/m0/s1.
What are the key properties of (2S)-2-but-2-enyl-2,3-dihydroinden-1-one?
(2S)-2-but-2-enyl-2,3-dihydroinden-1-one has a molecular weight of 186.25 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-but-2-enyl-2,3-dihydroinden-1-one is sourced from PubChem (CID 67713890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).