C13H17NO3 — CID 67714078
ethenyl 4,4-dimethyl-7-oxo-1,3,3a,7a-tetrahydroisoindole-2-carboxylate (PubChem CID 67714078) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is ethenyl 4,4-dimethyl-7-oxo-1,3,3a,7a-tetrahydroisoindole-2-carboxylate.
| Compound Name | ethenyl 4,4-dimethyl-7-oxo-1,3,3a,7a-tetrahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 67714078 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | ethenyl 4,4-dimethyl-7-oxo-1,3,3a,7a-tetrahydroisoindole-2-carboxylate |
| SMILES | C=COC(=O)N1CC2C(=O)C=CC(C)(C)C2C1 |
| InChI | InChI=1S/C13H17NO3/c1-4-17-12(16)14-7-9-10(8-14)13(2,3)6-5-11(9)15/h4-6,9-10H,1,7-8H2,2-3H3 |
| InChIKey | LGOIESAIRZAGOX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|