C27H29N3O5S2 — CID 67714141
N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]-5-phenyl-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 67714141) has the molecular formula C27H29N3O5S2 and a molecular weight of 539.68 g/mol. Its IUPAC name is N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]-5-phenyl-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]-5-phenyl-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 67714141 |
| Molecular Formula | C27H29N3O5S2 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | N-[1-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)butyl]-5-phenyl-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | CCCC(NS(=O)(=O)c1c(-c2ccccc2)ccc2nsnc12)c1c(O)c2c(oc1=O)CCCCCC2 |
| InChI | InChI=1S/C27H29N3O5S2/c1-2-10-20(23-25(31)19-13-8-3-4-9-14-22(19)35-27(23)32)30-37(33,34)26-18(17-11-6-5-7-12-17)15-16-21-24(26)29-36-28-21/h5-7,11-12,15-16,20,30-31H,2-4,8-10,13-14H2,1H3 |
| InChIKey | WPJGYAMHDVUEGF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |