C10H15NO — CID 67714376
7,7-dimethyl-2,3,3a,7a-tetrahydro-1H-isoindol-4-one (PubChem CID 67714376) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 7,7-dimethyl-2,3,3a,7a-tetrahydro-1H-isoindol-4-one.
| Compound Name | 7,7-dimethyl-2,3,3a,7a-tetrahydro-1H-isoindol-4-one |
|---|---|
| PubChem CID | 67714376 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 7,7-dimethyl-2,3,3a,7a-tetrahydro-1H-isoindol-4-one |
| SMILES | CC1(C)C=CC(=O)C2CNCC21 |
| InChI | InChI=1S/C10H15NO/c1-10(2)4-3-9(12)7-5-11-6-8(7)10/h3-4,7-8,11H,5-6H2,1-2H3 |
| InChIKey | WARZCXOZAMJICB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |