About 8-[4-(1,3-dioxolan-2-yl)butyl]-3-methyl-2-phenylchromen-4-one
8-[4-(1,3-dioxolan-2-yl)butyl]-3-methyl-2-phenylchromen-4-one (PubChem CID 67714607) has the molecular formula C23H24O4
and a molecular weight of 364.44 g/mol. Its IUPAC name is 8-[4-(1,3-dioxolan-2-yl)butyl]-3-methyl-2-phenylchromen-4-one.
Molecular Properties
| Compound Name | 8-[4-(1,3-dioxolan-2-yl)butyl]-3-methyl-2-phenylchromen-4-one |
| PubChem CID | 67714607 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 8-[4-(1,3-dioxolan-2-yl)butyl]-3-methyl-2-phenylchromen-4-one |
| SMILES | Cc1c(-c2ccccc2)oc2c(CCCCC3OCCO3)cccc2c1=O |
| InChI | InChI=1S/C23H24O4/c1-16-21(24)19-12-7-11-18(10-5-6-13-20-25-14-15-26-20)23(19)27-22(16)17-8-3-2-4-9-17/h2-4,7-9,11-12,20H,5-6,10,13-15H2,1H3 |
| InChIKey | KLAMFADKNPPUHL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-[4-(1,3-dioxolan-2-yl)butyl]-3-methyl-2-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4-(1,3-dioxolan-2-yl)butyl]-3-methyl-2-phenylchromen-4-one?
The IUPAC name of 8-[4-(1,3-dioxolan-2-yl)butyl]-3-methyl-2-phenylchromen-4-one (CID 67714607) is 8-[4-(1,3-dioxolan-2-yl)butyl]-3-methyl-2-phenylchromen-4-one.
What is the SMILES notation for 8-[4-(1,3-dioxolan-2-yl)butyl]-3-methyl-2-phenylchromen-4-one?
The canonical SMILES for 8-[4-(1,3-dioxolan-2-yl)butyl]-3-methyl-2-phenylchromen-4-one is Cc1c(-c2ccccc2)oc2c(CCCCC3OCCO3)cccc2c1=O.
What is the InChIKey of 8-[4-(1,3-dioxolan-2-yl)butyl]-3-methyl-2-phenylchromen-4-one?
The InChIKey is KLAMFADKNPPUHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24O4/c1-16-21(24)19-12-7-11-18(10-5-6-13-20-25-14-15-26-20)23(19)27-22(16)17-8-3-2-4-9-17/h2-4,7-9,11-12,20H,5-6,10,13-15H2,1H3.
What are the key properties of 8-[4-(1,3-dioxolan-2-yl)butyl]-3-methyl-2-phenylchromen-4-one?
8-[4-(1,3-dioxolan-2-yl)butyl]-3-methyl-2-phenylchromen-4-one has a molecular weight of 364.44 g/mol, XLogP of 4.85, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4-(1,3-dioxolan-2-yl)butyl]-3-methyl-2-phenylchromen-4-one is sourced from PubChem (CID 67714607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).