C19H14N2O3 — CID 67714689
6-[(8-hydroxyquinolin-4-yl)methylidene]-4,7-dihydroisoquinoline-1,3-dione (PubChem CID 67714689) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is 6-[(8-hydroxyquinolin-4-yl)methylidene]-4,7-dihydroisoquinoline-1,3-dione.
| Compound Name | 6-[(8-hydroxyquinolin-4-yl)methylidene]-4,7-dihydroisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 67714689 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 6-[(8-hydroxyquinolin-4-yl)methylidene]-4,7-dihydroisoquinoline-1,3-dione |
| SMILES | O=C1CC2=CC(=Cc3ccnc4c(O)cccc34)CC=C2C(=O)N1 |
| InChI | InChI=1S/C19H14N2O3/c22-16-3-1-2-14-12(6-7-20-18(14)16)8-11-4-5-15-13(9-11)10-17(23)21-19(15)24/h1-3,5-9,22H,4,10H2,(H,21,23,24) |
| InChIKey | NLOPSAILNRZCFJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|