C10H12MgN2O3S — CID 67714775
CID 67714775 (PubChem CID 67714775) has the molecular formula C10H12MgN2O3S and a molecular weight of 264.59 g/mol.
| Compound Name | CID 67714775 |
|---|---|
| PubChem CID | 67714775 |
| Molecular Formula | C10H12MgN2O3S |
| Molecular Weight | 264.59 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | — |
| SMILES | CC(C)N1C(=O)c2ccccc2NS1(=O)=O.[Mg] |
| InChI | InChI=1S/C10H12N2O3S.Mg/c1-7(2)12-10(13)8-5-3-4-6-9(8)11-16(12,14)15;/h3-7,11H,1-2H3; |
| InChIKey | NPIVNUOEMOAFBN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.59 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |