About 8-[4-(1,3-dioxolan-2-yl)but-1-enyl]-3-methyl-2-phenylchromen-4-one
8-[4-(1,3-dioxolan-2-yl)but-1-enyl]-3-methyl-2-phenylchromen-4-one (PubChem CID 67715075) has the molecular formula C23H22O4
and a molecular weight of 362.43 g/mol. Its IUPAC name is 8-[4-(1,3-dioxolan-2-yl)but-1-enyl]-3-methyl-2-phenylchromen-4-one.
Molecular Properties
| Compound Name | 8-[4-(1,3-dioxolan-2-yl)but-1-enyl]-3-methyl-2-phenylchromen-4-one |
| PubChem CID | 67715075 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 8-[4-(1,3-dioxolan-2-yl)but-1-enyl]-3-methyl-2-phenylchromen-4-one |
| SMILES | Cc1c(-c2ccccc2)oc2c(C=CCCC3OCCO3)cccc2c1=O |
| InChI | InChI=1S/C23H22O4/c1-16-21(24)19-12-7-11-18(10-5-6-13-20-25-14-15-26-20)23(19)27-22(16)17-8-3-2-4-9-17/h2-5,7-12,20H,6,13-15H2,1H3 |
| InChIKey | QHTCDKIQEBNHEE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-[4-(1,3-dioxolan-2-yl)but-1-enyl]-3-methyl-2-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4-(1,3-dioxolan-2-yl)but-1-enyl]-3-methyl-2-phenylchromen-4-one?
The IUPAC name of 8-[4-(1,3-dioxolan-2-yl)but-1-enyl]-3-methyl-2-phenylchromen-4-one (CID 67715075) is 8-[4-(1,3-dioxolan-2-yl)but-1-enyl]-3-methyl-2-phenylchromen-4-one.
What is the SMILES notation for 8-[4-(1,3-dioxolan-2-yl)but-1-enyl]-3-methyl-2-phenylchromen-4-one?
The canonical SMILES for 8-[4-(1,3-dioxolan-2-yl)but-1-enyl]-3-methyl-2-phenylchromen-4-one is Cc1c(-c2ccccc2)oc2c(C=CCCC3OCCO3)cccc2c1=O.
What is the InChIKey of 8-[4-(1,3-dioxolan-2-yl)but-1-enyl]-3-methyl-2-phenylchromen-4-one?
The InChIKey is QHTCDKIQEBNHEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O4/c1-16-21(24)19-12-7-11-18(10-5-6-13-20-25-14-15-26-20)23(19)27-22(16)17-8-3-2-4-9-17/h2-5,7-12,20H,6,13-15H2,1H3.
What are the key properties of 8-[4-(1,3-dioxolan-2-yl)but-1-enyl]-3-methyl-2-phenylchromen-4-one?
8-[4-(1,3-dioxolan-2-yl)but-1-enyl]-3-methyl-2-phenylchromen-4-one has a molecular weight of 362.43 g/mol, XLogP of 4.93, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4-(1,3-dioxolan-2-yl)but-1-enyl]-3-methyl-2-phenylchromen-4-one is sourced from PubChem (CID 67715075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).