About 4-propyl-2H-furo[3,2-b]pyridin-6-amine
4-propyl-2H-furo[3,2-b]pyridin-6-amine (PubChem CID 67715089) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-propyl-2H-furo[3,2-b]pyridin-6-amine.
Molecular Properties
| Compound Name | 4-propyl-2H-furo[3,2-b]pyridin-6-amine |
| PubChem CID | 67715089 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 4-propyl-2H-furo[3,2-b]pyridin-6-amine |
| SMILES | CCCN1C=C(N)C=C2OCC=C21 |
| InChI | InChI=1S/C10H14N2O/c1-2-4-12-7-8(11)6-10-9(12)3-5-13-10/h3,6-7H,2,4-5,11H2,1H3 |
| InChIKey | SAPFPEYHJTWFNB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propyl-2H-furo[3,2-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propyl-2H-furo[3,2-b]pyridin-6-amine?
The IUPAC name of 4-propyl-2H-furo[3,2-b]pyridin-6-amine (CID 67715089) is 4-propyl-2H-furo[3,2-b]pyridin-6-amine.
What is the SMILES notation for 4-propyl-2H-furo[3,2-b]pyridin-6-amine?
The canonical SMILES for 4-propyl-2H-furo[3,2-b]pyridin-6-amine is CCCN1C=C(N)C=C2OCC=C21.
What is the InChIKey of 4-propyl-2H-furo[3,2-b]pyridin-6-amine?
The InChIKey is SAPFPEYHJTWFNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-2-4-12-7-8(11)6-10-9(12)3-5-13-10/h3,6-7H,2,4-5,11H2,1H3.
What are the key properties of 4-propyl-2H-furo[3,2-b]pyridin-6-amine?
4-propyl-2H-furo[3,2-b]pyridin-6-amine has a molecular weight of 178.23 g/mol, XLogP of 1.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propyl-2H-furo[3,2-b]pyridin-6-amine is sourced from PubChem (CID 67715089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).