About 4-methyl-11,11-dioxo-10-(trifluoromethyl)-5H-benzo[b][1,4]benzothiazepin-6-one
4-methyl-11,11-dioxo-10-(trifluoromethyl)-5H-benzo[b][1,4]benzothiazepin-6-one (PubChem CID 67715240) has the molecular formula C15H10F3NO3S
and a molecular weight of 341.31 g/mol. Its IUPAC name is 4-methyl-11,11-dioxo-10-(trifluoromethyl)-5H-benzo[b][1,4]benzothiazepin-6-one.
Molecular Properties
| Compound Name | 4-methyl-11,11-dioxo-10-(trifluoromethyl)-5H-benzo[b][1,4]benzothiazepin-6-one |
| PubChem CID | 67715240 |
| Molecular Formula | C15H10F3NO3S |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 4-methyl-11,11-dioxo-10-(trifluoromethyl)-5H-benzo[b][1,4]benzothiazepin-6-one |
| SMILES | Cc1cccc2c1NC(=O)c1cccc(C(F)(F)F)c1S2(=O)=O |
| InChI | InChI=1S/C15H10F3NO3S/c1-8-4-2-7-11-12(8)19-14(20)9-5-3-6-10(15(16,17)18)13(9)23(11,21)22/h2-7H,1H3,(H,19,20) |
| InChIKey | QLVPHFCWKXLBPK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-11,11-dioxo-10-(trifluoromethyl)-5H-benzo[b][1,4]benzothiazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-11,11-dioxo-10-(trifluoromethyl)-5H-benzo[b][1,4]benzothiazepin-6-one?
The IUPAC name of 4-methyl-11,11-dioxo-10-(trifluoromethyl)-5H-benzo[b][1,4]benzothiazepin-6-one (CID 67715240) is 4-methyl-11,11-dioxo-10-(trifluoromethyl)-5H-benzo[b][1,4]benzothiazepin-6-one.
What is the SMILES notation for 4-methyl-11,11-dioxo-10-(trifluoromethyl)-5H-benzo[b][1,4]benzothiazepin-6-one?
The canonical SMILES for 4-methyl-11,11-dioxo-10-(trifluoromethyl)-5H-benzo[b][1,4]benzothiazepin-6-one is Cc1cccc2c1NC(=O)c1cccc(C(F)(F)F)c1S2(=O)=O.
What is the InChIKey of 4-methyl-11,11-dioxo-10-(trifluoromethyl)-5H-benzo[b][1,4]benzothiazepin-6-one?
The InChIKey is QLVPHFCWKXLBPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F3NO3S/c1-8-4-2-7-11-12(8)19-14(20)9-5-3-6-10(15(16,17)18)13(9)23(11,21)22/h2-7H,1H3,(H,19,20).
What are the key properties of 4-methyl-11,11-dioxo-10-(trifluoromethyl)-5H-benzo[b][1,4]benzothiazepin-6-one?
4-methyl-11,11-dioxo-10-(trifluoromethyl)-5H-benzo[b][1,4]benzothiazepin-6-one has a molecular weight of 341.31 g/mol, XLogP of 3.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-11,11-dioxo-10-(trifluoromethyl)-5H-benzo[b][1,4]benzothiazepin-6-one is sourced from PubChem (CID 67715240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).