About trisodium;4-propan-2-ylbenzene-1,2,3-tricarboxylate
trisodium;4-propan-2-ylbenzene-1,2,3-tricarboxylate (PubChem CID 67715339) has the molecular formula C12H9Na3O6
and a molecular weight of 318.17 g/mol. Its IUPAC name is trisodium;4-propan-2-ylbenzene-1,2,3-tricarboxylate.
Molecular Properties
| Compound Name | trisodium;4-propan-2-ylbenzene-1,2,3-tricarboxylate |
| PubChem CID | 67715339 |
| Molecular Formula | C12H9Na3O6 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | trisodium;4-propan-2-ylbenzene-1,2,3-tricarboxylate |
| SMILES | CC(C)c1ccc(C(=O)[O-])c(C(=O)[O-])c1C(=O)[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C12H12O6.3Na/c1-5(2)6-3-4-7(10(13)14)9(12(17)18)8(6)11(15)16;;;/h3-5H,1-2H3,(H,13,14)(H,15,16)(H,17,18);;;/q;3*+1/p-3 |
| InChIKey | ZXLQGZOGSFSDSR-UHFFFAOYSA-K |
| XLogP | -11.09 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | -11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze trisodium;4-propan-2-ylbenzene-1,2,3-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;4-propan-2-ylbenzene-1,2,3-tricarboxylate?
The IUPAC name of trisodium;4-propan-2-ylbenzene-1,2,3-tricarboxylate (CID 67715339) is trisodium;4-propan-2-ylbenzene-1,2,3-tricarboxylate.
What is the SMILES notation for trisodium;4-propan-2-ylbenzene-1,2,3-tricarboxylate?
The canonical SMILES for trisodium;4-propan-2-ylbenzene-1,2,3-tricarboxylate is CC(C)c1ccc(C(=O)[O-])c(C(=O)[O-])c1C(=O)[O-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;4-propan-2-ylbenzene-1,2,3-tricarboxylate?
The InChIKey is ZXLQGZOGSFSDSR-UHFFFAOYSA-K. The full InChI is InChI=1S/C12H12O6.3Na/c1-5(2)6-3-4-7(10(13)14)9(12(17)18)8(6)11(15)16;;;/h3-5H,1-2H3,(H,13,14)(H,15,16)(H,17,18);;;/q;3*+1/p-3.
What are the key properties of trisodium;4-propan-2-ylbenzene-1,2,3-tricarboxylate?
trisodium;4-propan-2-ylbenzene-1,2,3-tricarboxylate has a molecular weight of 318.17 g/mol, XLogP of -11.09, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;4-propan-2-ylbenzene-1,2,3-tricarboxylate is sourced from PubChem (CID 67715339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).