C21H23F3N2O4S — CID 67715591
[7-[2-[5-(5-methylfuran-2-yl)pentylamino]ethyl]-2-oxo-3H-1,3-benzothiazol-4-yl] 2,2,2-trifluoroacetate (PubChem CID 67715591) has the molecular formula C21H23F3N2O4S and a molecular weight of 456.49 g/mol. Its IUPAC name is [7-[2-[5-(5-methylfuran-2-yl)pentylamino]ethyl]-2-oxo-3H-1,3-benzothiazol-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [7-[2-[5-(5-methylfuran-2-yl)pentylamino]ethyl]-2-oxo-3H-1,3-benzothiazol-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67715591 |
| Molecular Formula | C21H23F3N2O4S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | [7-[2-[5-(5-methylfuran-2-yl)pentylamino]ethyl]-2-oxo-3H-1,3-benzothiazol-4-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(CCCCCNCCc2ccc(OC(=O)C(F)(F)F)c3[nH]c(=O)sc23)o1 |
| InChI | InChI=1S/C21H23F3N2O4S/c1-13-6-8-15(29-13)5-3-2-4-11-25-12-10-14-7-9-16(30-19(27)21(22,23)24)17-18(14)31-20(28)26-17/h6-9,25H,2-5,10-12H2,1H3,(H,26,28) |
| InChIKey | BZHDPQOGYVLJGG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|