C31H53N3O7 — CID 67715707
4-[[(2S,4S,5S,7S)-4-amino-7-(butylcarbamoyl)-5-hydroxy-8-methyl-2-propan-2-ylnonyl]carbamoyl]-3-(4-methoxybutoxy)benzoic acid (PubChem CID 67715707) has the molecular formula C31H53N3O7 and a molecular weight of 579.78 g/mol. Its IUPAC name is 4-[[(2S,4S,5S,7S)-4-amino-7-(butylcarbamoyl)-5-hydroxy-8-methyl-2-propan-2-ylnonyl]carbamoyl]-3-(4-methoxybutoxy)benzoic acid.
| Compound Name | 4-[[(2S,4S,5S,7S)-4-amino-7-(butylcarbamoyl)-5-hydroxy-8-methyl-2-propan-2-ylnonyl]carbamoyl]-3-(4-methoxybutoxy)benzoic acid |
|---|---|
| PubChem CID | 67715707 |
| Molecular Formula | C31H53N3O7 |
| Molecular Weight | 579.78 g/mol |
| Exact Mass | 579.39 |
| IUPAC Name | 4-[[(2S,4S,5S,7S)-4-amino-7-(butylcarbamoyl)-5-hydroxy-8-methyl-2-propan-2-ylnonyl]carbamoyl]-3-(4-methoxybutoxy)benzoic acid |
| SMILES | CCCCNC(=O)[C@@H](C[C@H](O)[C@@H](N)C[C@H](CNC(=O)c1ccc(C(=O)O)cc1OCCCCOC)C(C)C)C(C)C |
| InChI | InChI=1S/C31H53N3O7/c1-7-8-13-33-30(37)25(21(4)5)18-27(35)26(32)16-23(20(2)3)19-34-29(36)24-12-11-22(31(38)39)17-28(24)41-15-10-9-14-40-6/h11-12,17,20-21,23,25-27,35H,7-10,13-16,18-19,32H2,1-6H3,(H,33,37)(H,34,36)(H,38,39)/t23-,25+,26+,27+/m1/s1 |
| InChIKey | NSRSIKJHRAAJFZ-BDGPUAICSA-N |
| XLogP | 3.85 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|