About tert-butyl 2-amino-2-[3-(1-methylquinolin-1-ium-3-yl)propanoyloxy]propanoate iodide
tert-butyl 2-amino-2-[3-(1-methylquinolin-1-ium-3-yl)propanoyloxy]propanoate iodide (PubChem CID 67716131) has the molecular formula C20H27IN2O4
and a molecular weight of 486.35 g/mol. Its IUPAC name is tert-butyl 2-amino-2-[3-(1-methylquinolin-1-ium-3-yl)propanoyloxy]propanoate iodide.
Molecular Properties
| Compound Name | tert-butyl 2-amino-2-[3-(1-methylquinolin-1-ium-3-yl)propanoyloxy]propanoate iodide |
| PubChem CID | 67716131 |
| Molecular Formula | C20H27IN2O4 |
| Molecular Weight | 486.35 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | tert-butyl 2-amino-2-[3-(1-methylquinolin-1-ium-3-yl)propanoyloxy]propanoate iodide |
| SMILES | C[n+]1cc(CCC(=O)OC(C)(N)C(=O)OC(C)(C)C)cc2ccccc21.[I-] |
| InChI | InChI=1S/C20H27N2O4.HI/c1-19(2,3)26-18(24)20(4,21)25-17(23)11-10-14-12-15-8-6-7-9-16(15)22(5)13-14;/h6-9,12-13H,10-11,21H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | UJFQAXGOBOCZDL-UHFFFAOYSA-M |
| XLogP | -0.84 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.35 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-amino-2-[3-(1-methylquinolin-1-ium-3-yl)propanoyloxy]propanoate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-amino-2-[3-(1-methylquinolin-1-ium-3-yl)propanoyloxy]propanoate iodide?
The IUPAC name of tert-butyl 2-amino-2-[3-(1-methylquinolin-1-ium-3-yl)propanoyloxy]propanoate iodide (CID 67716131) is tert-butyl 2-amino-2-[3-(1-methylquinolin-1-ium-3-yl)propanoyloxy]propanoate iodide.
What is the SMILES notation for tert-butyl 2-amino-2-[3-(1-methylquinolin-1-ium-3-yl)propanoyloxy]propanoate iodide?
The canonical SMILES for tert-butyl 2-amino-2-[3-(1-methylquinolin-1-ium-3-yl)propanoyloxy]propanoate iodide is C[n+]1cc(CCC(=O)OC(C)(N)C(=O)OC(C)(C)C)cc2ccccc21.[I-].
What is the InChIKey of tert-butyl 2-amino-2-[3-(1-methylquinolin-1-ium-3-yl)propanoyloxy]propanoate iodide?
The InChIKey is UJFQAXGOBOCZDL-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H27N2O4.HI/c1-19(2,3)26-18(24)20(4,21)25-17(23)11-10-14-12-15-8-6-7-9-16(15)22(5)13-14;/h6-9,12-13H,10-11,21H2,1-5H3;1H/q+1;/p-1.
What are the key properties of tert-butyl 2-amino-2-[3-(1-methylquinolin-1-ium-3-yl)propanoyloxy]propanoate iodide?
tert-butyl 2-amino-2-[3-(1-methylquinolin-1-ium-3-yl)propanoyloxy]propanoate iodide has a molecular weight of 486.35 g/mol, XLogP of -0.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-amino-2-[3-(1-methylquinolin-1-ium-3-yl)propanoyloxy]propanoate iodide is sourced from PubChem (CID 67716131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).