C24H35NO8 — CID 67716264
7-O-tert-butyl 1-O-ethyl 1-O-methyl 2-amino-1-benzoyloxyheptane-1,1,7-tricarboxylate (PubChem CID 67716264) has the molecular formula C24H35NO8 and a molecular weight of 465.54 g/mol. Its IUPAC name is 7-O-tert-butyl 1-O-ethyl 1-O-methyl 2-amino-1-benzoyloxyheptane-1,1,7-tricarboxylate.
| Compound Name | 7-O-tert-butyl 1-O-ethyl 1-O-methyl 2-amino-1-benzoyloxyheptane-1,1,7-tricarboxylate |
|---|---|
| PubChem CID | 67716264 |
| Molecular Formula | C24H35NO8 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 7-O-tert-butyl 1-O-ethyl 1-O-methyl 2-amino-1-benzoyloxyheptane-1,1,7-tricarboxylate |
| SMILES | CCOC(=O)C(OC(=O)c1ccccc1)(C(=O)OC)C(N)CCCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H35NO8/c1-6-31-22(29)24(21(28)30-5,33-20(27)17-13-9-7-10-14-17)18(25)15-11-8-12-16-19(26)32-23(2,3)4/h7,9-10,13-14,18H,6,8,11-12,15-16,25H2,1-5H3 |
| InChIKey | HIBHUUFSIKSFRC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|