About 1-acetyl-3,7-dihydropurine-2,6-dione
1-acetyl-3,7-dihydropurine-2,6-dione (PubChem CID 67716532) has the molecular formula C7H6N4O3
and a molecular weight of 194.15 g/mol. Its IUPAC name is 1-acetyl-3,7-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | 1-acetyl-3,7-dihydropurine-2,6-dione |
| PubChem CID | 67716532 |
| Molecular Formula | C7H6N4O3 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 1-acetyl-3,7-dihydropurine-2,6-dione |
| SMILES | CC(=O)n1c(=O)[nH]c2nc[nH]c2c1=O |
| InChI | InChI=1S/C7H6N4O3/c1-3(12)11-6(13)4-5(9-2-8-4)10-7(11)14/h2H,1H3,(H,8,9)(H,10,14) |
| InChIKey | KRYDHLPTKWHKQZ-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-acetyl-3,7-dihydropurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-3,7-dihydropurine-2,6-dione?
The IUPAC name of 1-acetyl-3,7-dihydropurine-2,6-dione (CID 67716532) is 1-acetyl-3,7-dihydropurine-2,6-dione.
What is the SMILES notation for 1-acetyl-3,7-dihydropurine-2,6-dione?
The canonical SMILES for 1-acetyl-3,7-dihydropurine-2,6-dione is CC(=O)n1c(=O)[nH]c2nc[nH]c2c1=O.
What is the InChIKey of 1-acetyl-3,7-dihydropurine-2,6-dione?
The InChIKey is KRYDHLPTKWHKQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O3/c1-3(12)11-6(13)4-5(9-2-8-4)10-7(11)14/h2H,1H3,(H,8,9)(H,10,14).
What are the key properties of 1-acetyl-3,7-dihydropurine-2,6-dione?
1-acetyl-3,7-dihydropurine-2,6-dione has a molecular weight of 194.15 g/mol, XLogP of -0.93, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-3,7-dihydropurine-2,6-dione is sourced from PubChem (CID 67716532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).