C25H34N4O3 — CID 67716584
5-[2-[6-(2-amino-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)hexylamino]ethyl]-1,2-dihydroindazol-3-one (PubChem CID 67716584) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 5-[2-[6-(2-amino-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)hexylamino]ethyl]-1,2-dihydroindazol-3-one.
| Compound Name | 5-[2-[6-(2-amino-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)hexylamino]ethyl]-1,2-dihydroindazol-3-one |
|---|---|
| PubChem CID | 67716584 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 5-[2-[6-(2-amino-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)hexylamino]ethyl]-1,2-dihydroindazol-3-one |
| SMILES | NC1CCc2c(ccc(O)c2O)C1CCCCCCNCCc1ccc2[nH][nH]c(=O)c2c1 |
| InChI | InChI=1S/C25H34N4O3/c26-21-9-7-19-17(8-11-23(30)24(19)31)18(21)5-3-1-2-4-13-27-14-12-16-6-10-22-20(15-16)25(32)29-28-22/h6,8,10-11,15,18,21,27,30-31H,1-5,7,9,12-14,26H2,(H2,28,29,32) |
| InChIKey | PHPQCDYEWGVECC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 127.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|