C25H34N4O3 — CID 67716588
5-[2-[2-(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-hexylhydrazinyl]ethyl]-1,2-dihydroindazol-3-one (PubChem CID 67716588) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 5-[2-[2-(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-hexylhydrazinyl]ethyl]-1,2-dihydroindazol-3-one.
| Compound Name | 5-[2-[2-(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-hexylhydrazinyl]ethyl]-1,2-dihydroindazol-3-one |
|---|---|
| PubChem CID | 67716588 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 5-[2-[2-(5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-hexylhydrazinyl]ethyl]-1,2-dihydroindazol-3-one |
| SMILES | CCCCCCN(NCCc1ccc2[nH][nH]c(=O)c2c1)C1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C25H34N4O3/c1-2-3-4-5-14-29(19-8-9-20-18(16-19)7-11-23(30)24(20)31)26-13-12-17-6-10-22-21(15-17)25(32)28-27-22/h6-7,10-11,15,19,26,30-31H,2-5,8-9,12-14,16H2,1H3,(H2,27,28,32) |
| InChIKey | SRIDVHJAKOHNGV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|