C20H30N2O3S — CID 67716618
1-[(2R)-2-[[5-(2-ethylsulfonylethyl)-1H-indol-3-yl]methyl]pyrrolidin-1-yl]propan-2-ol (PubChem CID 67716618) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is 1-[(2R)-2-[[5-(2-ethylsulfonylethyl)-1H-indol-3-yl]methyl]pyrrolidin-1-yl]propan-2-ol.
| Compound Name | 1-[(2R)-2-[[5-(2-ethylsulfonylethyl)-1H-indol-3-yl]methyl]pyrrolidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 67716618 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 1-[(2R)-2-[[5-(2-ethylsulfonylethyl)-1H-indol-3-yl]methyl]pyrrolidin-1-yl]propan-2-ol |
| SMILES | CCS(=O)(=O)CCc1ccc2[nH]cc(C[C@H]3CCCN3CC(C)O)c2c1 |
| InChI | InChI=1S/C20H30N2O3S/c1-3-26(24,25)10-8-16-6-7-20-19(11-16)17(13-21-20)12-18-5-4-9-22(18)14-15(2)23/h6-7,11,13,15,18,21,23H,3-5,8-10,12,14H2,1-2H3/t15?,18-/m1/s1 |
| InChIKey | UTTCRKBLRZASMH-KPMSDPLLSA-N |
| XLogP | 2.53 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |