About N-[[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl]-N-phenylaniline
N-[[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl]-N-phenylaniline (PubChem CID 67716628) has the molecular formula C31H29N3O4
and a molecular weight of 507.59 g/mol. Its IUPAC name is N-[[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl]-N-phenylaniline.
Molecular Properties
| Compound Name | N-[[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl]-N-phenylaniline |
| PubChem CID | 67716628 |
| Molecular Formula | C31H29N3O4 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | N-[[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl]-N-phenylaniline |
| SMILES | COc1ccc(-c2nc(CN(c3ccccc3)c3ccccc3)nc3cc(OC)c(OC)cc23)cc1OC |
| InChI | InChI=1S/C31H29N3O4/c1-35-26-16-15-21(17-27(26)36-2)31-24-18-28(37-3)29(38-4)19-25(24)32-30(33-31)20-34(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-19H,20H2,1-4H3 |
| InChIKey | AOCIKYWWWJITMH-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl]-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl]-N-phenylaniline?
The IUPAC name of N-[[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl]-N-phenylaniline (CID 67716628) is N-[[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl]-N-phenylaniline.
What is the SMILES notation for N-[[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl]-N-phenylaniline?
The canonical SMILES for N-[[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl]-N-phenylaniline is COc1ccc(-c2nc(CN(c3ccccc3)c3ccccc3)nc3cc(OC)c(OC)cc23)cc1OC.
What is the InChIKey of N-[[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl]-N-phenylaniline?
The InChIKey is AOCIKYWWWJITMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H29N3O4/c1-35-26-16-15-21(17-27(26)36-2)31-24-18-28(37-3)29(38-4)19-25(24)32-30(33-31)20-34(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-19H,20H2,1-4H3.
What are the key properties of N-[[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl]-N-phenylaniline?
N-[[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl]-N-phenylaniline has a molecular weight of 507.59 g/mol, XLogP of 6.67, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl]-N-phenylaniline is sourced from PubChem (CID 67716628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).