C25H39Cl2N3O4S — CID 67716938
N-[4-[2-[6-(2-amino-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)hexylamino]ethyl]phenyl]methanesulfonamide;dihydrochloride (PubChem CID 67716938) has the molecular formula C25H39Cl2N3O4S and a molecular weight of 548.58 g/mol. Its IUPAC name is N-[4-[2-[6-(2-amino-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)hexylamino]ethyl]phenyl]methanesulfonamide;dihydrochloride.
| Compound Name | N-[4-[2-[6-(2-amino-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)hexylamino]ethyl]phenyl]methanesulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 67716938 |
| Molecular Formula | C25H39Cl2N3O4S |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | N-[4-[2-[6-(2-amino-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)hexylamino]ethyl]phenyl]methanesulfonamide;dihydrochloride |
| SMILES | CS(=O)(=O)Nc1ccc(CCNCCCCCCC2c3ccc(O)c(O)c3CCC2N)cc1.Cl.Cl |
| InChI | InChI=1S/C25H37N3O4S.2ClH/c1-33(31,32)28-19-9-7-18(8-10-19)15-17-27-16-5-3-2-4-6-21-20-12-14-24(29)25(30)22(20)11-13-23(21)26;;/h7-10,12,14,21,23,27-30H,2-6,11,13,15-17,26H2,1H3;2*1H |
| InChIKey | OCYBIDQOXDVNLH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|