C25H36N2O4 — CID 67716996
6-[hexyl-[2-(3-hydroxy-4-methoxyphenyl)ethylamino]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol (PubChem CID 67716996) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is 6-[hexyl-[2-(3-hydroxy-4-methoxyphenyl)ethylamino]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol.
| Compound Name | 6-[hexyl-[2-(3-hydroxy-4-methoxyphenyl)ethylamino]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 67716996 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 6-[hexyl-[2-(3-hydroxy-4-methoxyphenyl)ethylamino]amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
| SMILES | CCCCCCN(NCCc1ccc(OC)c(O)c1)C1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C25H36N2O4/c1-3-4-5-6-15-27(26-14-13-18-7-12-24(31-2)23(29)16-18)20-9-10-21-19(17-20)8-11-22(28)25(21)30/h7-8,11-12,16,20,26,28-30H,3-6,9-10,13-15,17H2,1-2H3 |
| InChIKey | RWHPLJMNDKEQEF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|