C27H20Br2O2 — CID 67717159
4',5-dibromo-1',8-dimethoxyspiro[4a,9a-dihydrofluorene-9,9'-fluorene] (PubChem CID 67717159) has the molecular formula C27H20Br2O2 and a molecular weight of 536.26 g/mol. Its IUPAC name is 4',5-dibromo-1',8-dimethoxyspiro[4a,9a-dihydrofluorene-9,9'-fluorene].
| Compound Name | 4',5-dibromo-1',8-dimethoxyspiro[4a,9a-dihydrofluorene-9,9'-fluorene] |
|---|---|
| PubChem CID | 67717159 |
| Molecular Formula | C27H20Br2O2 |
| Molecular Weight | 536.26 g/mol |
| Exact Mass | 533.98 |
| IUPAC Name | 4',5-dibromo-1',8-dimethoxyspiro[4a,9a-dihydrofluorene-9,9'-fluorene] |
| SMILES | COc1ccc(Br)c2c1C1(c3ccccc3-2)c2c(OC)ccc(Br)c2C2C=CC=CC21 |
| InChI | InChI=1S/C27H20Br2O2/c1-30-21-13-11-19(28)23-15-7-3-5-9-17(15)27(25(21)23)18-10-6-4-8-16(18)24-20(29)12-14-22(31-2)26(24)27/h3-15,17H,1-2H3 |
| InChIKey | KIXAXEPYXZOVIS-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.26 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |