About 4-(2-butylimidazo[1,2-a]pyridin-3-yl)-2-methylbenzoic acid;hydrochloride
4-(2-butylimidazo[1,2-a]pyridin-3-yl)-2-methylbenzoic acid;hydrochloride (PubChem CID 67717536) has the molecular formula C19H21ClN2O2
and a molecular weight of 344.84 g/mol. Its IUPAC name is 4-(2-butylimidazo[1,2-a]pyridin-3-yl)-2-methylbenzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 4-(2-butylimidazo[1,2-a]pyridin-3-yl)-2-methylbenzoic acid;hydrochloride |
| PubChem CID | 67717536 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-(2-butylimidazo[1,2-a]pyridin-3-yl)-2-methylbenzoic acid;hydrochloride |
| SMILES | CCCCc1nc2ccccn2c1-c1ccc(C(=O)O)c(C)c1.Cl |
| InChI | InChI=1S/C19H20N2O2.ClH/c1-3-4-7-16-18(21-11-6-5-8-17(21)20-16)14-9-10-15(19(22)23)13(2)12-14;/h5-6,8-12H,3-4,7H2,1-2H3,(H,22,23);1H |
| InChIKey | LNPQWPXEPBBTSS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-butylimidazo[1,2-a]pyridin-3-yl)-2-methylbenzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-butylimidazo[1,2-a]pyridin-3-yl)-2-methylbenzoic acid;hydrochloride?
The IUPAC name of 4-(2-butylimidazo[1,2-a]pyridin-3-yl)-2-methylbenzoic acid;hydrochloride (CID 67717536) is 4-(2-butylimidazo[1,2-a]pyridin-3-yl)-2-methylbenzoic acid;hydrochloride.
What is the SMILES notation for 4-(2-butylimidazo[1,2-a]pyridin-3-yl)-2-methylbenzoic acid;hydrochloride?
The canonical SMILES for 4-(2-butylimidazo[1,2-a]pyridin-3-yl)-2-methylbenzoic acid;hydrochloride is CCCCc1nc2ccccn2c1-c1ccc(C(=O)O)c(C)c1.Cl.
What is the InChIKey of 4-(2-butylimidazo[1,2-a]pyridin-3-yl)-2-methylbenzoic acid;hydrochloride?
The InChIKey is LNPQWPXEPBBTSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O2.ClH/c1-3-4-7-16-18(21-11-6-5-8-17(21)20-16)14-9-10-15(19(22)23)13(2)12-14;/h5-6,8-12H,3-4,7H2,1-2H3,(H,22,23);1H.
What are the key properties of 4-(2-butylimidazo[1,2-a]pyridin-3-yl)-2-methylbenzoic acid;hydrochloride?
4-(2-butylimidazo[1,2-a]pyridin-3-yl)-2-methylbenzoic acid;hydrochloride has a molecular weight of 344.84 g/mol, XLogP of 4.77, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-butylimidazo[1,2-a]pyridin-3-yl)-2-methylbenzoic acid;hydrochloride is sourced from PubChem (CID 67717536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).