C31H62N6O — CID 67717628
2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-[(2,2,6,6-tetramethylpiperidin-4-yl)-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]amino]propanamide (PubChem CID 67717628) has the molecular formula C31H62N6O and a molecular weight of 534.88 g/mol. Its IUPAC name is 2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-[(2,2,6,6-tetramethylpiperidin-4-yl)-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]amino]propanamide.
| Compound Name | 2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-[(2,2,6,6-tetramethylpiperidin-4-yl)-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]amino]propanamide |
|---|---|
| PubChem CID | 67717628 |
| Molecular Formula | C31H62N6O |
| Molecular Weight | 534.88 g/mol |
| Exact Mass | 534.50 |
| IUPAC Name | 2-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-[(2,2,6,6-tetramethylpiperidin-4-yl)-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]amino]propanamide |
| SMILES | CC1(C)CC(NC(=O)C(C)(C)N(NC2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C31H62N6O/c1-25(2)15-21(16-26(3,4)34-25)32-24(38)31(13,14)37(23-19-29(9,10)36-30(11,12)20-23)33-22-17-27(5,6)35-28(7,8)18-22/h21-23,33-36H,15-20H2,1-14H3,(H,32,38) |
| InChIKey | SYSKOBUTHSSJLP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.88 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|