C21H14N4O6S — CID 67718159
4-[(7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-4-carbonyl)sulfamoyl]benzoic acid (PubChem CID 67718159) has the molecular formula C21H14N4O6S and a molecular weight of 450.43 g/mol. Its IUPAC name is 4-[(7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-4-carbonyl)sulfamoyl]benzoic acid.
| Compound Name | 4-[(7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-4-carbonyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 67718159 |
| Molecular Formula | C21H14N4O6S |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 4-[(7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-4-carbonyl)sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NC(=O)c2cn3c4c([nH]c(=O)c3n2)-c2ccccc2C4)cc1 |
| InChI | InChI=1S/C21H14N4O6S/c26-19(24-32(30,31)13-7-5-11(6-8-13)21(28)29)15-10-25-16-9-12-3-1-2-4-14(12)17(16)23-20(27)18(25)22-15/h1-8,10H,9H2,(H,23,27)(H,24,26)(H,28,29) |
| InChIKey | BLSLPSFGLOOGRR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |