C9H8ClNO3S — CID 67718228
6-chloro-2-ethyl-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 67718228) has the molecular formula C9H8ClNO3S and a molecular weight of 245.69 g/mol. Its IUPAC name is 6-chloro-2-ethyl-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 6-chloro-2-ethyl-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 67718228 |
| Molecular Formula | C9H8ClNO3S |
| Molecular Weight | 245.69 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 6-chloro-2-ethyl-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | CCN1C(=O)c2ccc(Cl)cc2S1(=O)=O |
| InChI | InChI=1S/C9H8ClNO3S/c1-2-11-9(12)7-4-3-6(10)5-8(7)15(11,13)14/h3-5H,2H2,1H3 |
| InChIKey | MHQWWYFHCJGGLY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.69 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |