C12H14N2O2S — CID 67719017
N-(2-oxo-1-prop-2-enylazetidin-3-yl)-2-thiophen-3-ylacetamide (PubChem CID 67719017) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is N-(2-oxo-1-prop-2-enylazetidin-3-yl)-2-thiophen-3-ylacetamide.
| Compound Name | N-(2-oxo-1-prop-2-enylazetidin-3-yl)-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 67719017 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | N-(2-oxo-1-prop-2-enylazetidin-3-yl)-2-thiophen-3-ylacetamide |
| SMILES | C=CCN1CC(NC(=O)Cc2ccsc2)C1=O |
| InChI | InChI=1S/C12H14N2O2S/c1-2-4-14-7-10(12(14)16)13-11(15)6-9-3-5-17-8-9/h2-3,5,8,10H,1,4,6-7H2,(H,13,15) |
| InChIKey | YVFNVXGRTUQYOR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|