C24H19ClN4O2 — CID 67719057
N-(1-benzylindol-5-yl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine;hydrochloride (PubChem CID 67719057) has the molecular formula C24H19ClN4O2 and a molecular weight of 430.90 g/mol. Its IUPAC name is N-(1-benzylindol-5-yl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine;hydrochloride.
| Compound Name | N-(1-benzylindol-5-yl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine;hydrochloride |
|---|---|
| PubChem CID | 67719057 |
| Molecular Formula | C24H19ClN4O2 |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N-(1-benzylindol-5-yl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine;hydrochloride |
| SMILES | Cl.c1ccc(Cn2ccc3cc(Nc4ncnc5cc6c(cc45)OCO6)ccc32)cc1 |
| InChI | InChI=1S/C24H18N4O2.ClH/c1-2-4-16(5-3-1)13-28-9-8-17-10-18(6-7-21(17)28)27-24-19-11-22-23(30-15-29-22)12-20(19)25-14-26-24;/h1-12,14H,13,15H2,(H,25,26,27);1H |
| InChIKey | ALDRUNMWFFQDQY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |