About [(2S)-butan-2-yl] N-[(2S)-2-amino-3-methylbutanoyl]-N-(1-cyclohexylethyl)carbamate
[(2S)-butan-2-yl] N-[(2S)-2-amino-3-methylbutanoyl]-N-(1-cyclohexylethyl)carbamate (PubChem CID 67719389) has the molecular formula C18H34N2O3
and a molecular weight of 326.48 g/mol. Its IUPAC name is [(2S)-butan-2-yl] N-[(2S)-2-amino-3-methylbutanoyl]-N-(1-cyclohexylethyl)carbamate.
Molecular Properties
| Compound Name | [(2S)-butan-2-yl] N-[(2S)-2-amino-3-methylbutanoyl]-N-(1-cyclohexylethyl)carbamate |
| PubChem CID | 67719389 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | [(2S)-butan-2-yl] N-[(2S)-2-amino-3-methylbutanoyl]-N-(1-cyclohexylethyl)carbamate |
| SMILES | CC[C@H](C)OC(=O)N(C(=O)[C@@H](N)C(C)C)C(C)C1CCCCC1 |
| InChI | InChI=1S/C18H34N2O3/c1-6-13(4)23-18(22)20(17(21)16(19)12(2)3)14(5)15-10-8-7-9-11-15/h12-16H,6-11,19H2,1-5H3/t13-,14?,16-/m0/s1 |
| InChIKey | MPUWZGBMPDABTB-SFIRGFGWSA-N |
| XLogP | 3.70 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-butan-2-yl] N-[(2S)-2-amino-3-methylbutanoyl]-N-(1-cyclohexylethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-butan-2-yl] N-[(2S)-2-amino-3-methylbutanoyl]-N-(1-cyclohexylethyl)carbamate?
The IUPAC name of [(2S)-butan-2-yl] N-[(2S)-2-amino-3-methylbutanoyl]-N-(1-cyclohexylethyl)carbamate (CID 67719389) is [(2S)-butan-2-yl] N-[(2S)-2-amino-3-methylbutanoyl]-N-(1-cyclohexylethyl)carbamate.
What is the SMILES notation for [(2S)-butan-2-yl] N-[(2S)-2-amino-3-methylbutanoyl]-N-(1-cyclohexylethyl)carbamate?
The canonical SMILES for [(2S)-butan-2-yl] N-[(2S)-2-amino-3-methylbutanoyl]-N-(1-cyclohexylethyl)carbamate is CC[C@H](C)OC(=O)N(C(=O)[C@@H](N)C(C)C)C(C)C1CCCCC1.
What is the InChIKey of [(2S)-butan-2-yl] N-[(2S)-2-amino-3-methylbutanoyl]-N-(1-cyclohexylethyl)carbamate?
The InChIKey is MPUWZGBMPDABTB-SFIRGFGWSA-N. The full InChI is InChI=1S/C18H34N2O3/c1-6-13(4)23-18(22)20(17(21)16(19)12(2)3)14(5)15-10-8-7-9-11-15/h12-16H,6-11,19H2,1-5H3/t13-,14?,16-/m0/s1.
What are the key properties of [(2S)-butan-2-yl] N-[(2S)-2-amino-3-methylbutanoyl]-N-(1-cyclohexylethyl)carbamate?
[(2S)-butan-2-yl] N-[(2S)-2-amino-3-methylbutanoyl]-N-(1-cyclohexylethyl)carbamate has a molecular weight of 326.48 g/mol, XLogP of 3.70, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-butan-2-yl] N-[(2S)-2-amino-3-methylbutanoyl]-N-(1-cyclohexylethyl)carbamate is sourced from PubChem (CID 67719389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).