About 1-hydroxyethyl 4-methoxybenzoate
1-hydroxyethyl 4-methoxybenzoate (PubChem CID 67719638) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is 1-hydroxyethyl 4-methoxybenzoate.
Molecular Properties
| Compound Name | 1-hydroxyethyl 4-methoxybenzoate |
| PubChem CID | 67719638 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-hydroxyethyl 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC(C)O)cc1 |
| InChI | InChI=1S/C10H12O4/c1-7(11)14-10(12)8-3-5-9(13-2)6-4-8/h3-7,11H,1-2H3 |
| InChIKey | KCEABMOHBXZMMJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyethyl 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyethyl 4-methoxybenzoate?
The IUPAC name of 1-hydroxyethyl 4-methoxybenzoate (CID 67719638) is 1-hydroxyethyl 4-methoxybenzoate.
What is the SMILES notation for 1-hydroxyethyl 4-methoxybenzoate?
The canonical SMILES for 1-hydroxyethyl 4-methoxybenzoate is COc1ccc(C(=O)OC(C)O)cc1.
What is the InChIKey of 1-hydroxyethyl 4-methoxybenzoate?
The InChIKey is KCEABMOHBXZMMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-7(11)14-10(12)8-3-5-9(13-2)6-4-8/h3-7,11H,1-2H3.
What are the key properties of 1-hydroxyethyl 4-methoxybenzoate?
1-hydroxyethyl 4-methoxybenzoate has a molecular weight of 196.20 g/mol, XLogP of 1.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyethyl 4-methoxybenzoate is sourced from PubChem (CID 67719638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).