About 1-(2,2-dimethoxybutyl)imidazolidine-2,4-dione
1-(2,2-dimethoxybutyl)imidazolidine-2,4-dione (PubChem CID 67719929) has the molecular formula C9H16N2O4
and a molecular weight of 216.24 g/mol. Its IUPAC name is 1-(2,2-dimethoxybutyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(2,2-dimethoxybutyl)imidazolidine-2,4-dione |
| PubChem CID | 67719929 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 1-(2,2-dimethoxybutyl)imidazolidine-2,4-dione |
| SMILES | CCC(CN1CC(=O)NC1=O)(OC)OC |
| InChI | InChI=1S/C9H16N2O4/c1-4-9(14-2,15-3)6-11-5-7(12)10-8(11)13/h4-6H2,1-3H3,(H,10,12,13) |
| InChIKey | BKBQFTOAIBYPLN-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethoxybutyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethoxybutyl)imidazolidine-2,4-dione?
The IUPAC name of 1-(2,2-dimethoxybutyl)imidazolidine-2,4-dione (CID 67719929) is 1-(2,2-dimethoxybutyl)imidazolidine-2,4-dione.
What is the SMILES notation for 1-(2,2-dimethoxybutyl)imidazolidine-2,4-dione?
The canonical SMILES for 1-(2,2-dimethoxybutyl)imidazolidine-2,4-dione is CCC(CN1CC(=O)NC1=O)(OC)OC.
What is the InChIKey of 1-(2,2-dimethoxybutyl)imidazolidine-2,4-dione?
The InChIKey is BKBQFTOAIBYPLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O4/c1-4-9(14-2,15-3)6-11-5-7(12)10-8(11)13/h4-6H2,1-3H3,(H,10,12,13).
What are the key properties of 1-(2,2-dimethoxybutyl)imidazolidine-2,4-dione?
1-(2,2-dimethoxybutyl)imidazolidine-2,4-dione has a molecular weight of 216.24 g/mol, XLogP of -0.06, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethoxybutyl)imidazolidine-2,4-dione is sourced from PubChem (CID 67719929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).