About 2-N-[4-(2-aminoethyl)cyclohexyl]quinazoline-2,4-diamine;hydrochloride
2-N-[4-(2-aminoethyl)cyclohexyl]quinazoline-2,4-diamine;hydrochloride (PubChem CID 67719963) has the molecular formula C16H24ClN5
and a molecular weight of 321.86 g/mol. Its IUPAC name is 2-N-[4-(2-aminoethyl)cyclohexyl]quinazoline-2,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-N-[4-(2-aminoethyl)cyclohexyl]quinazoline-2,4-diamine;hydrochloride |
| PubChem CID | 67719963 |
| Molecular Formula | C16H24ClN5 |
| Molecular Weight | 321.86 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-N-[4-(2-aminoethyl)cyclohexyl]quinazoline-2,4-diamine;hydrochloride |
| SMILES | Cl.NCCC1CCC(Nc2nc(N)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C16H23N5.ClH/c17-10-9-11-5-7-12(8-6-11)19-16-20-14-4-2-1-3-13(14)15(18)21-16;/h1-4,11-12H,5-10,17H2,(H3,18,19,20,21);1H |
| InChIKey | UIAWPISQALCVCZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.86 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N-[4-(2-aminoethyl)cyclohexyl]quinazoline-2,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[4-(2-aminoethyl)cyclohexyl]quinazoline-2,4-diamine;hydrochloride?
The IUPAC name of 2-N-[4-(2-aminoethyl)cyclohexyl]quinazoline-2,4-diamine;hydrochloride (CID 67719963) is 2-N-[4-(2-aminoethyl)cyclohexyl]quinazoline-2,4-diamine;hydrochloride.
What is the SMILES notation for 2-N-[4-(2-aminoethyl)cyclohexyl]quinazoline-2,4-diamine;hydrochloride?
The canonical SMILES for 2-N-[4-(2-aminoethyl)cyclohexyl]quinazoline-2,4-diamine;hydrochloride is Cl.NCCC1CCC(Nc2nc(N)c3ccccc3n2)CC1.
What is the InChIKey of 2-N-[4-(2-aminoethyl)cyclohexyl]quinazoline-2,4-diamine;hydrochloride?
The InChIKey is UIAWPISQALCVCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5.ClH/c17-10-9-11-5-7-12(8-6-11)19-16-20-14-4-2-1-3-13(14)15(18)21-16;/h1-4,11-12H,5-10,17H2,(H3,18,19,20,21);1H.
What are the key properties of 2-N-[4-(2-aminoethyl)cyclohexyl]quinazoline-2,4-diamine;hydrochloride?
2-N-[4-(2-aminoethyl)cyclohexyl]quinazoline-2,4-diamine;hydrochloride has a molecular weight of 321.86 g/mol, XLogP of 2.95, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[4-(2-aminoethyl)cyclohexyl]quinazoline-2,4-diamine;hydrochloride is sourced from PubChem (CID 67719963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).