C11H19NO4 — CID 67720271
(3aS)-1,2,3,3a,4,5,6,7,8,8a-decahydrocyclohepta[c]pyrrole;oxalic acid (PubChem CID 67720271) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is (3aS)-1,2,3,3a,4,5,6,7,8,8a-decahydrocyclohepta[c]pyrrole;oxalic acid.
| Compound Name | (3aS)-1,2,3,3a,4,5,6,7,8,8a-decahydrocyclohepta[c]pyrrole;oxalic acid |
|---|---|
| PubChem CID | 67720271 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (3aS)-1,2,3,3a,4,5,6,7,8,8a-decahydrocyclohepta[c]pyrrole;oxalic acid |
| SMILES | C1CCC2CNC[C@H]2CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C9H17N.C2H2O4/c1-2-4-8-6-10-7-9(8)5-3-1;3-1(4)2(5)6/h8-10H,1-7H2;(H,3,4)(H,5,6)/t8-,9?;/m1./s1 |
| InChIKey | URJJQFUNKCOMKT-URIXSHMWSA-N |
| XLogP | 0.94 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|