C16H22ClNO — CID 67720463
(3aS,9bS)-6-methoxy-3-prop-2-enyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole;hydrochloride (PubChem CID 67720463) has the molecular formula C16H22ClNO and a molecular weight of 279.81 g/mol. Its IUPAC name is (3aS,9bS)-6-methoxy-3-prop-2-enyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole;hydrochloride.
| Compound Name | (3aS,9bS)-6-methoxy-3-prop-2-enyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole;hydrochloride |
|---|---|
| PubChem CID | 67720463 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (3aS,9bS)-6-methoxy-3-prop-2-enyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole;hydrochloride |
| SMILES | C=CCN1CC[C@H]2c3cccc(OC)c3CC[C@@H]21.Cl |
| InChI | InChI=1S/C16H21NO.ClH/c1-3-10-17-11-9-13-12-5-4-6-16(18-2)14(12)7-8-15(13)17;/h3-6,13,15H,1,7-11H2,2H3;1H/t13-,15-;/m0./s1 |
| InChIKey | UHKRDCUHXNNGHA-SLHAJLBXSA-N |
| XLogP | 3.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|