About methyl 1-methoxy-5,10-dioxo-8,9-dihydro-1H-benzo[g]isochromene-3-carboxylate
methyl 1-methoxy-5,10-dioxo-8,9-dihydro-1H-benzo[g]isochromene-3-carboxylate (PubChem CID 67720501) has the molecular formula C16H14O6
and a molecular weight of 302.28 g/mol. Its IUPAC name is methyl 1-methoxy-5,10-dioxo-8,9-dihydro-1H-benzo[g]isochromene-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-methoxy-5,10-dioxo-8,9-dihydro-1H-benzo[g]isochromene-3-carboxylate |
| PubChem CID | 67720501 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | methyl 1-methoxy-5,10-dioxo-8,9-dihydro-1H-benzo[g]isochromene-3-carboxylate |
| SMILES | COC(=O)C1=CC2=C(C(=O)C3=C(C=CCC3)C2=O)C(OC)O1 |
| InChI | InChI=1S/C16H14O6/c1-20-15(19)11-7-10-12(16(21-2)22-11)14(18)9-6-4-3-5-8(9)13(10)17/h3,5,7,16H,4,6H2,1-2H3 |
| InChIKey | RSGKSNLAOBIWCQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-methoxy-5,10-dioxo-8,9-dihydro-1H-benzo[g]isochromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-methoxy-5,10-dioxo-8,9-dihydro-1H-benzo[g]isochromene-3-carboxylate?
The IUPAC name of methyl 1-methoxy-5,10-dioxo-8,9-dihydro-1H-benzo[g]isochromene-3-carboxylate (CID 67720501) is methyl 1-methoxy-5,10-dioxo-8,9-dihydro-1H-benzo[g]isochromene-3-carboxylate.
What is the SMILES notation for methyl 1-methoxy-5,10-dioxo-8,9-dihydro-1H-benzo[g]isochromene-3-carboxylate?
The canonical SMILES for methyl 1-methoxy-5,10-dioxo-8,9-dihydro-1H-benzo[g]isochromene-3-carboxylate is COC(=O)C1=CC2=C(C(=O)C3=C(C=CCC3)C2=O)C(OC)O1.
What is the InChIKey of methyl 1-methoxy-5,10-dioxo-8,9-dihydro-1H-benzo[g]isochromene-3-carboxylate?
The InChIKey is RSGKSNLAOBIWCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O6/c1-20-15(19)11-7-10-12(16(21-2)22-11)14(18)9-6-4-3-5-8(9)13(10)17/h3,5,7,16H,4,6H2,1-2H3.
What are the key properties of methyl 1-methoxy-5,10-dioxo-8,9-dihydro-1H-benzo[g]isochromene-3-carboxylate?
methyl 1-methoxy-5,10-dioxo-8,9-dihydro-1H-benzo[g]isochromene-3-carboxylate has a molecular weight of 302.28 g/mol, XLogP of 1.14, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-methoxy-5,10-dioxo-8,9-dihydro-1H-benzo[g]isochromene-3-carboxylate is sourced from PubChem (CID 67720501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).