C25H26O2 — CID 67720642
4-(1,3,4,5-tetramethyl-5,6,7,8-tetrahydroanthracen-2-yl)benzoic acid (PubChem CID 67720642) has the molecular formula C25H26O2 and a molecular weight of 358.48 g/mol. Its IUPAC name is 4-(1,3,4,5-tetramethyl-5,6,7,8-tetrahydroanthracen-2-yl)benzoic acid.
| Compound Name | 4-(1,3,4,5-tetramethyl-5,6,7,8-tetrahydroanthracen-2-yl)benzoic acid |
|---|---|
| PubChem CID | 67720642 |
| Molecular Formula | C25H26O2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 4-(1,3,4,5-tetramethyl-5,6,7,8-tetrahydroanthracen-2-yl)benzoic acid |
| SMILES | Cc1c(-c2ccc(C(=O)O)cc2)c(C)c2cc3c(cc2c1C)C(C)CCC3 |
| InChI | InChI=1S/C25H26O2/c1-14-6-5-7-20-12-22-17(4)24(16(3)15(2)23(22)13-21(14)20)18-8-10-19(11-9-18)25(26)27/h8-14H,5-7H2,1-4H3,(H,26,27) |
| InChIKey | VCXGFWOVXWNHSI-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |