C19H14O6 — CID 67721058
methyl 6-hydroxy-5,12-dioxo-3,4-dihydro-1H-naphtho[2,3-g]isochromene-3-carboxylate (PubChem CID 67721058) has the molecular formula C19H14O6 and a molecular weight of 338.32 g/mol. Its IUPAC name is methyl 6-hydroxy-5,12-dioxo-3,4-dihydro-1H-naphtho[2,3-g]isochromene-3-carboxylate.
| Compound Name | methyl 6-hydroxy-5,12-dioxo-3,4-dihydro-1H-naphtho[2,3-g]isochromene-3-carboxylate |
|---|---|
| PubChem CID | 67721058 |
| Molecular Formula | C19H14O6 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | methyl 6-hydroxy-5,12-dioxo-3,4-dihydro-1H-naphtho[2,3-g]isochromene-3-carboxylate |
| SMILES | COC(=O)C1CC2=C(CO1)C(=O)c1cc3ccccc3c(O)c1C2=O |
| InChI | InChI=1S/C19H14O6/c1-24-19(23)14-7-11-13(8-25-14)16(20)12-6-9-4-2-3-5-10(9)17(21)15(12)18(11)22/h2-6,14,21H,7-8H2,1H3 |
| InChIKey | UEVVFNQVANRARL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|