About 1-hydroxy-5,8-dimethoxy-1-methyl-3,4-dihydroisochromene-3-carboxylic acid
1-hydroxy-5,8-dimethoxy-1-methyl-3,4-dihydroisochromene-3-carboxylic acid (PubChem CID 67721074) has the molecular formula C13H16O6
and a molecular weight of 268.26 g/mol. Its IUPAC name is 1-hydroxy-5,8-dimethoxy-1-methyl-3,4-dihydroisochromene-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-hydroxy-5,8-dimethoxy-1-methyl-3,4-dihydroisochromene-3-carboxylic acid |
| PubChem CID | 67721074 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 1-hydroxy-5,8-dimethoxy-1-methyl-3,4-dihydroisochromene-3-carboxylic acid |
| SMILES | COc1ccc(OC)c2c1CC(C(=O)O)OC2(C)O |
| InChI | InChI=1S/C13H16O6/c1-13(16)11-7(6-10(19-13)12(14)15)8(17-2)4-5-9(11)18-3/h4-5,10,16H,6H2,1-3H3,(H,14,15) |
| InChIKey | YNEZZXSZZMPPHH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-hydroxy-5,8-dimethoxy-1-methyl-3,4-dihydroisochromene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-5,8-dimethoxy-1-methyl-3,4-dihydroisochromene-3-carboxylic acid?
The IUPAC name of 1-hydroxy-5,8-dimethoxy-1-methyl-3,4-dihydroisochromene-3-carboxylic acid (CID 67721074) is 1-hydroxy-5,8-dimethoxy-1-methyl-3,4-dihydroisochromene-3-carboxylic acid.
What is the SMILES notation for 1-hydroxy-5,8-dimethoxy-1-methyl-3,4-dihydroisochromene-3-carboxylic acid?
The canonical SMILES for 1-hydroxy-5,8-dimethoxy-1-methyl-3,4-dihydroisochromene-3-carboxylic acid is COc1ccc(OC)c2c1CC(C(=O)O)OC2(C)O.
What is the InChIKey of 1-hydroxy-5,8-dimethoxy-1-methyl-3,4-dihydroisochromene-3-carboxylic acid?
The InChIKey is YNEZZXSZZMPPHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O6/c1-13(16)11-7(6-10(19-13)12(14)15)8(17-2)4-5-9(11)18-3/h4-5,10,16H,6H2,1-3H3,(H,14,15).
What are the key properties of 1-hydroxy-5,8-dimethoxy-1-methyl-3,4-dihydroisochromene-3-carboxylic acid?
1-hydroxy-5,8-dimethoxy-1-methyl-3,4-dihydroisochromene-3-carboxylic acid has a molecular weight of 268.26 g/mol, XLogP of 0.89, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-5,8-dimethoxy-1-methyl-3,4-dihydroisochromene-3-carboxylic acid is sourced from PubChem (CID 67721074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).