About 2-amino-4-(4-chlorophenyl)sulfanylbicyclo[3.1.0]hexane-2,6-dicarboxylic acid
2-amino-4-(4-chlorophenyl)sulfanylbicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 67721268) has the molecular formula C14H14ClNO4S
and a molecular weight of 327.79 g/mol. Its IUPAC name is 2-amino-4-(4-chlorophenyl)sulfanylbicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-amino-4-(4-chlorophenyl)sulfanylbicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| PubChem CID | 67721268 |
| Molecular Formula | C14H14ClNO4S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 2-amino-4-(4-chlorophenyl)sulfanylbicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | NC1(C(=O)O)CC(Sc2ccc(Cl)cc2)C2C(C(=O)O)C21 |
| InChI | InChI=1S/C14H14ClNO4S/c15-6-1-3-7(4-2-6)21-8-5-14(16,13(19)20)11-9(8)10(11)12(17)18/h1-4,8-11H,5,16H2,(H,17,18)(H,19,20) |
| InChIKey | RVXWYWFEYFLGQM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-(4-chlorophenyl)sulfanylbicyclo[3.1.0]hexane-2,6-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(4-chlorophenyl)sulfanylbicyclo[3.1.0]hexane-2,6-dicarboxylic acid?
The IUPAC name of 2-amino-4-(4-chlorophenyl)sulfanylbicyclo[3.1.0]hexane-2,6-dicarboxylic acid (CID 67721268) is 2-amino-4-(4-chlorophenyl)sulfanylbicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
What is the SMILES notation for 2-amino-4-(4-chlorophenyl)sulfanylbicyclo[3.1.0]hexane-2,6-dicarboxylic acid?
The canonical SMILES for 2-amino-4-(4-chlorophenyl)sulfanylbicyclo[3.1.0]hexane-2,6-dicarboxylic acid is NC1(C(=O)O)CC(Sc2ccc(Cl)cc2)C2C(C(=O)O)C21.
What is the InChIKey of 2-amino-4-(4-chlorophenyl)sulfanylbicyclo[3.1.0]hexane-2,6-dicarboxylic acid?
The InChIKey is RVXWYWFEYFLGQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClNO4S/c15-6-1-3-7(4-2-6)21-8-5-14(16,13(19)20)11-9(8)10(11)12(17)18/h1-4,8-11H,5,16H2,(H,17,18)(H,19,20).
What are the key properties of 2-amino-4-(4-chlorophenyl)sulfanylbicyclo[3.1.0]hexane-2,6-dicarboxylic acid?
2-amino-4-(4-chlorophenyl)sulfanylbicyclo[3.1.0]hexane-2,6-dicarboxylic acid has a molecular weight of 327.79 g/mol, XLogP of 1.93, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(4-chlorophenyl)sulfanylbicyclo[3.1.0]hexane-2,6-dicarboxylic acid is sourced from PubChem (CID 67721268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).