C21H16O7 — CID 67721311
6-acetyloxy-1-methyl-5,12-dioxo-3,4-dihydro-1H-naphtho[2,3-g]isochromene-3-carboxylic acid (PubChem CID 67721311) has the molecular formula C21H16O7 and a molecular weight of 380.35 g/mol. Its IUPAC name is 6-acetyloxy-1-methyl-5,12-dioxo-3,4-dihydro-1H-naphtho[2,3-g]isochromene-3-carboxylic acid.
| Compound Name | 6-acetyloxy-1-methyl-5,12-dioxo-3,4-dihydro-1H-naphtho[2,3-g]isochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 67721311 |
| Molecular Formula | C21H16O7 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 6-acetyloxy-1-methyl-5,12-dioxo-3,4-dihydro-1H-naphtho[2,3-g]isochromene-3-carboxylic acid |
| SMILES | CC(=O)Oc1c2c(cc3ccccc13)C(=O)C1=C(CC(C(=O)O)OC1C)C2=O |
| InChI | InChI=1S/C21H16O7/c1-9-16-14(8-15(27-9)21(25)26)19(24)17-13(18(16)23)7-11-5-3-4-6-12(11)20(17)28-10(2)22/h3-7,9,15H,8H2,1-2H3,(H,25,26) |
| InChIKey | QMHPXFLDYXFMQI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|