C20H16O6 — CID 67721468
(1R,3R)-3-acetyl-6-hydroxy-1-methoxy-3,4-dihydro-1H-naphtho[2,3-g]isochromene-5,12-dione (PubChem CID 67721468) has the molecular formula C20H16O6 and a molecular weight of 352.34 g/mol. Its IUPAC name is (1R,3R)-3-acetyl-6-hydroxy-1-methoxy-3,4-dihydro-1H-naphtho[2,3-g]isochromene-5,12-dione.
| Compound Name | (1R,3R)-3-acetyl-6-hydroxy-1-methoxy-3,4-dihydro-1H-naphtho[2,3-g]isochromene-5,12-dione |
|---|---|
| PubChem CID | 67721468 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (1R,3R)-3-acetyl-6-hydroxy-1-methoxy-3,4-dihydro-1H-naphtho[2,3-g]isochromene-5,12-dione |
| SMILES | CO[C@@H]1O[C@@H](C(C)=O)CC2=C1C(=O)c1cc3ccccc3c(O)c1C2=O |
| InChI | InChI=1S/C20H16O6/c1-9(21)14-8-13-16(20(25-2)26-14)19(24)12-7-10-5-3-4-6-11(10)17(22)15(12)18(13)23/h3-7,14,20,22H,8H2,1-2H3/t14-,20-/m1/s1 |
| InChIKey | ZQPAOLJFMBMVLB-JLTOFOAXSA-N |
| XLogP | 2.57 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|