C15H15NO — CID 67721503
(13R,17S)-11-oxa-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene (PubChem CID 67721503) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is (13R,17S)-11-oxa-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene.
| Compound Name | (13R,17S)-11-oxa-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene |
|---|---|
| PubChem CID | 67721503 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (13R,17S)-11-oxa-15-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8-pentaene |
| SMILES | c1ccc2c3c(ccc2c1)OC[C@H]1CNC[C@H]31 |
| InChI | InChI=1S/C15H15NO/c1-2-4-12-10(3-1)5-6-14-15(12)13-8-16-7-11(13)9-17-14/h1-6,11,13,16H,7-9H2/t11-,13+/m1/s1 |
| InChIKey | TTWAXOWGLOFVPH-YPMHNXCESA-N |
| XLogP | 2.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |