C46H56N2O4 — CID 67721624
bis[2-(dipropylamino)-8-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl] oxalate (PubChem CID 67721624) has the molecular formula C46H56N2O4 and a molecular weight of 700.96 g/mol. Its IUPAC name is bis[2-(dipropylamino)-8-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl] oxalate.
| Compound Name | bis[2-(dipropylamino)-8-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl] oxalate |
|---|---|
| PubChem CID | 67721624 |
| Molecular Formula | C46H56N2O4 |
| Molecular Weight | 700.96 g/mol |
| Exact Mass | 700.42 |
| IUPAC Name | bis[2-(dipropylamino)-8-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl] oxalate |
| SMILES | CCCN(CCC)C1CCc2cccc(-c3ccccc3)c2C1OC(=O)C(=O)OC1c2c(cccc2-c2ccccc2)CCC1N(CCC)CCC |
| InChI | InChI=1S/C46H56N2O4/c1-5-29-47(30-6-2)39-27-25-35-21-15-23-37(33-17-11-9-12-18-33)41(35)43(39)51-45(49)46(50)52-44-40(48(31-7-3)32-8-4)28-26-36-22-16-24-38(42(36)44)34-19-13-10-14-20-34/h9-24,39-40,43-44H,5-8,25-32H2,1-4H3 |
| InChIKey | ZDTJCPSSUXQMLH-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.96 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|